About phenalen-1-one
phenalen-1-one (PubChem CID 11050) has the molecular formula C13H8O
and a molecular weight of 180.21 g/mol. Its IUPAC name is phenalen-1-one.
Molecular Properties
| Compound Name | phenalen-1-one |
| PubChem CID | 11050 |
| Molecular Formula | C13H8O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | phenalen-1-one |
| SMILES | O=C1C=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C13H8O/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-8H |
| InChIKey | WWBGWPHHLRSTFI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenalen-1-one?
The IUPAC name of phenalen-1-one (CID 11050) is phenalen-1-one.
What is the SMILES notation for phenalen-1-one?
The canonical SMILES for phenalen-1-one is O=C1C=Cc2cccc3cccc1c23.
What is the InChIKey of phenalen-1-one?
The InChIKey is WWBGWPHHLRSTFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-8H.
What are the key properties of phenalen-1-one?
phenalen-1-one has a molecular weight of 180.21 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenalen-1-one is sourced from PubChem (CID 11050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).