C27H45BrO4Si2 — CID 11050057
(4R,5S)-1-(4-bromobut-2-ynyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]cyclopent-2-en-1-ol (PubChem CID 11050057) has the molecular formula C27H45BrO4Si2 and a molecular weight of 569.73 g/mol. Its IUPAC name is (4R,5S)-1-(4-bromobut-2-ynyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]cyclopent-2-en-1-ol.
| Compound Name | (4R,5S)-1-(4-bromobut-2-ynyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11050057 |
| Molecular Formula | C27H45BrO4Si2 |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | (4R,5S)-1-(4-bromobut-2-ynyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]cyclopent-2-en-1-ol |
| SMILES | C/C(C#CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C1(O)CC#CCBr)=C/CO |
| InChI | InChI=1S/C27H45BrO4Si2/c1-21(16-19-29)14-15-22-20-23(31-33(8,9)25(2,3)4)24(27(22,30)17-12-13-18-28)32-34(10,11)26(5,6)7/h16,20,23-24,29-30H,17-19H2,1-11H3/b21-16-/t23-,24+,27?/m1/s1 |
| InChIKey | KCSOFKVVLKNXIW-PEVNDGDFSA-N |
| XLogP | 6.17 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|