C33H32F2O7Si — CID 11050303
[(2R,4aR,6S,7R,8S,8aR)-7-[(3,4-difluorophenyl)-dimethylsilyl]oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] naphthalene-2-carboxylate (PubChem CID 11050303) has the molecular formula C33H32F2O7Si and a molecular weight of 606.69 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-7-[(3,4-difluorophenyl)-dimethylsilyl]oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] naphthalene-2-carboxylate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-7-[(3,4-difluorophenyl)-dimethylsilyl]oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 11050303 |
| Molecular Formula | C33H32F2O7Si |
| Molecular Weight | 606.69 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-7-[(3,4-difluorophenyl)-dimethylsilyl]oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] naphthalene-2-carboxylate |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OC(=O)c2ccc3ccccc3c2)[C@H]1O[Si](C)(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C33H32F2O7Si/c1-37-33-30(42-43(2,3)24-15-16-25(34)26(35)18-24)29(40-31(36)23-14-13-20-9-7-8-12-22(20)17-23)28-27(39-33)19-38-32(41-28)21-10-5-4-6-11-21/h4-18,27-30,32-33H,19H2,1-3H3/t27-,28-,29+,30-,32-,33+/m1/s1 |
| InChIKey | IQLYNVQFUXYFBO-KTBPBYQKSA-N |
| XLogP | 5.63 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.69 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|