C29H52O3S2Sn — CID 11050449
(2S,4R)-6-phenylmethoxy-1-(2-tributylstannyl-1,3-dithian-2-yl)hexane-2,4-diol (PubChem CID 11050449) has the molecular formula C29H52O3S2Sn and a molecular weight of 631.58 g/mol. Its IUPAC name is (2S,4R)-6-phenylmethoxy-1-(2-tributylstannyl-1,3-dithian-2-yl)hexane-2,4-diol.
| Compound Name | (2S,4R)-6-phenylmethoxy-1-(2-tributylstannyl-1,3-dithian-2-yl)hexane-2,4-diol |
|---|---|
| PubChem CID | 11050449 |
| Molecular Formula | C29H52O3S2Sn |
| Molecular Weight | 631.58 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | (2S,4R)-6-phenylmethoxy-1-(2-tributylstannyl-1,3-dithian-2-yl)hexane-2,4-diol |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1(C[C@@H](O)C[C@H](O)CCOCc2ccccc2)SCCCS1 |
| InChI | InChI=1S/C17H25O3S2.3C4H9.Sn/c18-15(7-8-20-13-14-5-2-1-3-6-14)11-16(19)12-17-21-9-4-10-22-17;3*1-3-4-2;/h1-3,5-6,15-16,18-19H,4,7-13H2;3*1,3-4H2,2H3;/t15-,16+;;;;/m1..../s1 |
| InChIKey | JYBJKDWQFDECDO-KKKOUCRWSA-N |
| XLogP | 8.05 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.58 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|