C31H39BrO5SSi — CID 11050450
[(2S)-2-[(4R,6S)-6-(benzenesulfonylmethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2-bromoethoxy]-tert-butyl-diphenylsilane (PubChem CID 11050450) has the molecular formula C31H39BrO5SSi and a molecular weight of 631.71 g/mol. Its IUPAC name is [(2S)-2-[(4R,6S)-6-(benzenesulfonylmethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2-bromoethoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2S)-2-[(4R,6S)-6-(benzenesulfonylmethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2-bromoethoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11050450 |
| Molecular Formula | C31H39BrO5SSi |
| Molecular Weight | 631.71 g/mol |
| Exact Mass | 630.15 |
| IUPAC Name | [(2S)-2-[(4R,6S)-6-(benzenesulfonylmethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2-bromoethoxy]-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H](CS(=O)(=O)c2ccccc2)C[C@H]([C@@H](Br)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C31H39BrO5SSi/c1-30(2,3)39(26-17-11-7-12-18-26,27-19-13-8-14-20-27)35-22-28(32)29-21-24(36-31(4,5)37-29)23-38(33,34)25-15-9-6-10-16-25/h6-20,24,28-29H,21-23H2,1-5H3/t24-,28-,29+/m0/s1 |
| InChIKey | MZRWNDXTWQXGAO-RVVSJWLRSA-N |
| XLogP | 5.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|