C40H42O7 — CID 11050482
[(2R,3aS,8bS)-1-[(E,3S)-3-benzoyloxy-4-methyloct-1-en-6-ynyl]-5-(4-methoxy-4-oxobutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-yl] 4-methylbenzoate (PubChem CID 11050482) has the molecular formula C40H42O7 and a molecular weight of 634.77 g/mol. Its IUPAC name is [(2R,3aS,8bS)-1-[(E,3S)-3-benzoyloxy-4-methyloct-1-en-6-ynyl]-5-(4-methoxy-4-oxobutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-yl] 4-methylbenzoate.
| Compound Name | [(2R,3aS,8bS)-1-[(E,3S)-3-benzoyloxy-4-methyloct-1-en-6-ynyl]-5-(4-methoxy-4-oxobutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 11050482 |
| Molecular Formula | C40H42O7 |
| Molecular Weight | 634.77 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | [(2R,3aS,8bS)-1-[(E,3S)-3-benzoyloxy-4-methyloct-1-en-6-ynyl]-5-(4-methoxy-4-oxobutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-yl] 4-methylbenzoate |
| SMILES | CC#CCC(C)[C@@H](/C=C/C1[C@H]2c3cccc(CCCC(=O)OC)c3O[C@H]2C[C@H]1OC(=O)c1ccc(C)cc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H42O7/c1-5-6-12-27(3)33(46-39(42)29-13-8-7-9-14-29)24-23-31-34(47-40(43)30-21-19-26(2)20-22-30)25-35-37(31)32-17-10-15-28(38(32)45-35)16-11-18-36(41)44-4/h7-10,13-15,17,19-24,27,31,33-35,37H,11-12,16,18,25H2,1-4H3/b24-23+/t27?,31?,33-,34-,35+,37+/m1/s1 |
| InChIKey | ANBWEQBRMQXSHC-RCBJFHEUSA-N |
| XLogP | 7.41 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.77 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|