C22H21N3O3 — CID 110506375
4-nitro-N-[(E)-[4-(3-phenylpropoxy)phenyl]methylideneamino]aniline (PubChem CID 110506375) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-nitro-N-[(E)-[4-(3-phenylpropoxy)phenyl]methylideneamino]aniline.
| Compound Name | 4-nitro-N-[(E)-[4-(3-phenylpropoxy)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 110506375 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 4-nitro-N-[(E)-[4-(3-phenylpropoxy)phenyl]methylideneamino]aniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2ccc(OCCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H21N3O3/c26-25(27)21-12-10-20(11-13-21)24-23-17-19-8-14-22(15-9-19)28-16-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-15,17,24H,4,7,16H2/b23-17+ |
| InChIKey | UEVLLWNZQJICRJ-HAVVHWLPSA-N |
| XLogP | 5.05 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|