About bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel
bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel (PubChem CID 11050655) has the molecular formula C34H26N6NiO6
and a molecular weight of 673.31 g/mol. Its IUPAC name is bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel.
Molecular Properties
| Compound Name | bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel |
| PubChem CID | 11050655 |
| Molecular Formula | C34H26N6NiO6 |
| Molecular Weight | 673.31 g/mol |
| Exact Mass | 672.13 |
| IUPAC Name | bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel |
| SMILES | COc1ccc(N/N=C2/C=C(C=O)C(=O)c3ncccc32)cc1.COc1ccc(N/N=C2/C=C(C=O)C(=O)c3ncccc32)cc1.[Ni] |
| InChI | InChI=1S/2C17H13N3O3.Ni/c2*1-23-13-6-4-12(5-7-13)19-20-15-9-11(10-21)17(22)16-14(15)3-2-8-18-16;/h2*2-10,19H,1H3;/b2*20-15-; |
| InChIKey | YBASSHNUZUGSBJ-YTKRQRDXSA-N |
| XLogP | 4.45 |
| TPSA | 161.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 673.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel?
The IUPAC name of bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel (CID 11050655) is bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel.
What is the SMILES notation for bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel?
The canonical SMILES for bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel is COc1ccc(N/N=C2/C=C(C=O)C(=O)c3ncccc32)cc1.COc1ccc(N/N=C2/C=C(C=O)C(=O)c3ncccc32)cc1.[Ni].
What is the InChIKey of bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel?
The InChIKey is YBASSHNUZUGSBJ-YTKRQRDXSA-N. The full InChI is InChI=1S/2C17H13N3O3.Ni/c2*1-23-13-6-4-12(5-7-13)19-20-15-9-11(10-21)17(22)16-14(15)3-2-8-18-16;/h2*2-10,19H,1H3;/b2*20-15-;.
What are the key properties of bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel?
bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel has a molecular weight of 673.31 g/mol, XLogP of 4.45, 8 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis((5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-8-oxoquinoline-7-carbaldehyde);nickel is sourced from PubChem (CID 11050655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).