C26H46Br2O8Si — CID 11050670
methyl (4E,7S,8R)-10,10-dibromo-8-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxydeca-4,9-dienoate (PubChem CID 11050670) has the molecular formula C26H46Br2O8Si and a molecular weight of 674.54 g/mol. Its IUPAC name is methyl (4E,7S,8R)-10,10-dibromo-8-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxydeca-4,9-dienoate.
| Compound Name | methyl (4E,7S,8R)-10,10-dibromo-8-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxydeca-4,9-dienoate |
|---|---|
| PubChem CID | 11050670 |
| Molecular Formula | C26H46Br2O8Si |
| Molecular Weight | 674.54 g/mol |
| Exact Mass | 672.13 |
| IUPAC Name | methyl (4E,7S,8R)-10,10-dibromo-8-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxydeca-4,9-dienoate |
| SMILES | COC(=O)CC/C=C/C[C@H](O[C@@H]1O[C@@H](C)[C@H](OC)[C@@H](OC)[C@H]1OC)[C@@H](C=C(Br)Br)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46Br2O8Si/c1-17-22(31-6)23(32-7)24(33-8)25(34-17)35-18(14-12-11-13-15-21(29)30-5)19(16-20(27)28)36-37(9,10)26(2,3)4/h11-12,16-19,22-25H,13-15H2,1-10H3/b12-11+/t17-,18-,19+,22-,23+,24+,25-/m0/s1 |
| InChIKey | TYDXCJBJBGJKHQ-PXQAXMDASA-N |
| XLogP | 6.08 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|