About 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol
2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol (PubChem CID 110507501) has the molecular formula C9H9Cl3N2O
and a molecular weight of 267.54 g/mol. Its IUPAC name is 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol.
Molecular Properties
| Compound Name | 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol |
| PubChem CID | 110507501 |
| Molecular Formula | C9H9Cl3N2O |
| Molecular Weight | 267.54 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol |
| SMILES | OCCN/N=C/c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H9Cl3N2O/c10-7-1-2-8(11)9(12)6(7)5-14-13-3-4-15/h1-2,5,13,15H,3-4H2/b14-5+ |
| InChIKey | QIOBUPOOPPOIMO-LHHJGKSTSA-N |
| XLogP | 2.56 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol?
The IUPAC name of 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol (CID 110507501) is 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol.
What is the SMILES notation for 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol?
The canonical SMILES for 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol is OCCN/N=C/c1c(Cl)ccc(Cl)c1Cl.
What is the InChIKey of 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol?
The InChIKey is QIOBUPOOPPOIMO-LHHJGKSTSA-N. The full InChI is InChI=1S/C9H9Cl3N2O/c10-7-1-2-8(11)9(12)6(7)5-14-13-3-4-15/h1-2,5,13,15H,3-4H2/b14-5+.
What are the key properties of 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol?
2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol has a molecular weight of 267.54 g/mol, XLogP of 2.56, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]ethanol is sourced from PubChem (CID 110507501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).