C12H17O2+ — CID 11051263
methyl-[4-methyl-4-(3-oxobutyl)cyclohexa-2,5-dien-1-ylidene]oxidanium (PubChem CID 11051263) has the molecular formula C12H17O2+ and a molecular weight of 193.27 g/mol. Its IUPAC name is methyl-[4-methyl-4-(3-oxobutyl)cyclohexa-2,5-dien-1-ylidene]oxidanium.
| Compound Name | methyl-[4-methyl-4-(3-oxobutyl)cyclohexa-2,5-dien-1-ylidene]oxidanium |
|---|---|
| PubChem CID | 11051263 |
| Molecular Formula | C12H17O2+ |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | methyl-[4-methyl-4-(3-oxobutyl)cyclohexa-2,5-dien-1-ylidene]oxidanium |
| SMILES | C[O+]=C1C=CC(C)(CCC(C)=O)C=C1 |
| InChI | InChI=1S/C12H17O2/c1-10(13)4-7-12(2)8-5-11(14-3)6-9-12/h5-6,8-9H,4,7H2,1-3H3/q+1 |
| InChIKey | DASGZKRMUNXWIB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 28.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|