C32H51 — CID 11051395
CID 11051395 (PubChem CID 11051395) has the molecular formula C32H51 and a molecular weight of 435.76 g/mol.
| Compound Name | CID 11051395 |
|---|---|
| PubChem CID | 11051395 |
| Molecular Formula | C32H51 |
| Molecular Weight | 435.76 g/mol |
| Exact Mass | 435.40 |
| IUPAC Name | — |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H]([C]5[CH][CH][CH][CH]5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H51/c1-22(2)9-8-10-23(3)28-15-16-29-27-14-13-26-21-25(24-11-6-7-12-24)17-19-31(26,4)30(27)18-20-32(28,29)5/h6-7,11-12,22-23,25-30H,8-10,13-21H2,1-5H3/t23-,25+,26+,27+,28-,29+,30+,31+,32-/m1/s1 |
| InChIKey | VZJCSROOWYIBIQ-ZITGZWIUSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.76 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |