C25H13F39O — CID 11051421
1,1,1,2,2,3,3,4,4,5,5,6,6,12,12,13,13,14,14,15,15,16,16,17,17,17-hexacosafluoro-9-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)heptadecan-9-ol (PubChem CID 11051421) has the molecular formula C25H13F39O and a molecular weight of 1070.30 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,12,12,13,13,14,14,15,15,16,16,17,17,17-hexacosafluoro-9-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)heptadecan-9-ol.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,12,12,13,13,14,14,15,15,16,16,17,17,17-hexacosafluoro-9-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)heptadecan-9-ol |
|---|---|
| PubChem CID | 11051421 |
| Molecular Formula | C25H13F39O |
| Molecular Weight | 1070.30 g/mol |
| Exact Mass | 1070.03 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,12,12,13,13,14,14,15,15,16,16,17,17,17-hexacosafluoro-9-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)heptadecan-9-ol |
| SMILES | OC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H13F39O/c26-8(27,11(32,33)14(38,39)17(44,45)20(50,51)23(56,57)58)4-1-7(65,2-5-9(28,29)12(34,35)15(40,41)18(46,47)21(52,53)24(59,60)61)3-6-10(30,31)13(36,37)16(42,43)19(48,49)22(54,55)25(62,63)64/h65H,1-6H2 |
| InChIKey | JIPYTADEEBFFJG-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.30 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|