C27H30N2O4 — CID 110515412
N-[(Z)-[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-methoxyphenyl)acetamide (PubChem CID 110515412) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[(Z)-[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(Z)-[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 110515412 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[(Z)-[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2ccc(OC)cc2)ccc1OCc1cc(C)ccc1C |
| InChI | InChI=1S/C27H30N2O4/c1-5-32-26-15-22(10-13-25(26)33-18-23-14-19(2)6-7-20(23)3)17-28-29-27(30)16-21-8-11-24(31-4)12-9-21/h6-15,17H,5,16,18H2,1-4H3,(H,29,30)/b28-17- |
| InChIKey | TUORNBOOYQQJAL-QRQIAZFYSA-N |
| XLogP | 4.98 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|