About 2-thiophen-2-ylpropanal
2-thiophen-2-ylpropanal (PubChem CID 11051743) has the molecular formula C7H8OS
and a molecular weight of 140.21 g/mol. Its IUPAC name is 2-thiophen-2-ylpropanal.
Molecular Properties
| Compound Name | 2-thiophen-2-ylpropanal |
| PubChem CID | 11051743 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 2-thiophen-2-ylpropanal |
| SMILES | CC(C=O)c1cccs1 |
| InChI | InChI=1S/C7H8OS/c1-6(5-8)7-3-2-4-9-7/h2-6H,1H3 |
| InChIKey | LWLHFHDNURUMPN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-thiophen-2-ylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylpropanal?
The IUPAC name of 2-thiophen-2-ylpropanal (CID 11051743) is 2-thiophen-2-ylpropanal.
What is the SMILES notation for 2-thiophen-2-ylpropanal?
The canonical SMILES for 2-thiophen-2-ylpropanal is CC(C=O)c1cccs1.
What is the InChIKey of 2-thiophen-2-ylpropanal?
The InChIKey is LWLHFHDNURUMPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS/c1-6(5-8)7-3-2-4-9-7/h2-6H,1H3.
What are the key properties of 2-thiophen-2-ylpropanal?
2-thiophen-2-ylpropanal has a molecular weight of 140.21 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylpropanal is sourced from PubChem (CID 11051743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).