C23H24N2O4S — CID 110517628
N-[(E)-[2-(phenoxymethyl)phenyl]methylideneamino]-4-propan-2-yloxybenzenesulfonamide (PubChem CID 110517628) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is N-[(E)-[2-(phenoxymethyl)phenyl]methylideneamino]-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | N-[(E)-[2-(phenoxymethyl)phenyl]methylideneamino]-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 110517628 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[(E)-[2-(phenoxymethyl)phenyl]methylideneamino]-4-propan-2-yloxybenzenesulfonamide |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N/N=C/c2ccccc2COc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O4S/c1-18(2)29-22-12-14-23(15-13-22)30(26,27)25-24-16-19-8-6-7-9-20(19)17-28-21-10-4-3-5-11-21/h3-16,18,25H,17H2,1-2H3/b24-16+ |
| InChIKey | PUESZMLABLTPJX-LFVJCYFKSA-N |
| XLogP | 4.37 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|