C16H17N3O7S — CID 110518051
N-[(E)-(5-hydroxy-4-methoxy-2-nitrophenyl)methylideneamino]-2-methoxy-5-methylbenzenesulfonamide (PubChem CID 110518051) has the molecular formula C16H17N3O7S and a molecular weight of 395.39 g/mol. Its IUPAC name is N-[(E)-(5-hydroxy-4-methoxy-2-nitrophenyl)methylideneamino]-2-methoxy-5-methylbenzenesulfonamide.
| Compound Name | N-[(E)-(5-hydroxy-4-methoxy-2-nitrophenyl)methylideneamino]-2-methoxy-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110518051 |
| Molecular Formula | C16H17N3O7S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-[(E)-(5-hydroxy-4-methoxy-2-nitrophenyl)methylideneamino]-2-methoxy-5-methylbenzenesulfonamide |
| SMILES | COc1cc([N+](=O)[O-])c(/C=N/NS(=O)(=O)c2cc(C)ccc2OC)cc1O |
| InChI | InChI=1S/C16H17N3O7S/c1-10-4-5-14(25-2)16(6-10)27(23,24)18-17-9-11-7-13(20)15(26-3)8-12(11)19(21)22/h4-9,18,20H,1-3H3/b17-9+ |
| InChIKey | NKYHMYGPDGLEKS-RQZCQDPDSA-N |
| XLogP | 1.94 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|