About 9-methylidene-1,6-dioxaspiro[4.5]decane
9-methylidene-1,6-dioxaspiro[4.5]decane (PubChem CID 11051875) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 9-methylidene-1,6-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-methylidene-1,6-dioxaspiro[4.5]decane |
| PubChem CID | 11051875 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 9-methylidene-1,6-dioxaspiro[4.5]decane |
| SMILES | C=C1CCOC2(CCCO2)C1 |
| InChI | InChI=1S/C9H14O2/c1-8-3-6-11-9(7-8)4-2-5-10-9/h1-7H2 |
| InChIKey | WVMWFFYZLXVLGG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-methylidene-1,6-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylidene-1,6-dioxaspiro[4.5]decane?
The IUPAC name of 9-methylidene-1,6-dioxaspiro[4.5]decane (CID 11051875) is 9-methylidene-1,6-dioxaspiro[4.5]decane.
What is the SMILES notation for 9-methylidene-1,6-dioxaspiro[4.5]decane?
The canonical SMILES for 9-methylidene-1,6-dioxaspiro[4.5]decane is C=C1CCOC2(CCCO2)C1.
What is the InChIKey of 9-methylidene-1,6-dioxaspiro[4.5]decane?
The InChIKey is WVMWFFYZLXVLGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-8-3-6-11-9(7-8)4-2-5-10-9/h1-7H2.
What are the key properties of 9-methylidene-1,6-dioxaspiro[4.5]decane?
9-methylidene-1,6-dioxaspiro[4.5]decane has a molecular weight of 154.21 g/mol, XLogP of 1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylidene-1,6-dioxaspiro[4.5]decane is sourced from PubChem (CID 11051875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).