C10H8Br2N4OS — CID 110519071
4-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 110519071) has the molecular formula C10H8Br2N4OS and a molecular weight of 392.08 g/mol. Its IUPAC name is 4-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110519071 |
| Molecular Formula | C10H8Br2N4OS |
| Molecular Weight | 392.08 g/mol |
| Exact Mass | 389.88 |
| IUPAC Name | 4-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1c(Br)cc(/C=N\n2cn[nH]c2=S)cc1Br |
| InChI | InChI=1S/C10H8Br2N4OS/c1-17-9-7(11)2-6(3-8(9)12)4-14-16-5-13-15-10(16)18/h2-5H,1H3,(H,15,18)/b14-4- |
| InChIKey | CIBOGQYBXGYHAX-CPSFFCFKSA-N |
| XLogP | 3.36 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.08 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|