C8H14O3 — CID 11051924
[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 11051924) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is [(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 11051924 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | [(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1CO |
| InChI | InChI=1S/C8H14O3/c1-4-6-7(5-9)11-8(2,3)10-6/h4,6-7,9H,1,5H2,2-3H3/t6-,7+/m0/s1 |
| InChIKey | GXJPMBQLUDQIAV-NKWVEPMBSA-N |
| XLogP | 0.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|