C26H26N4O2S — CID 110519938
4-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 110519938) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is 4-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110519938 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 4-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(/C=N\n2c(CCc3ccccc3)n[nH]c2=S)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H26N4O2S/c1-2-31-24-17-22(13-15-23(24)32-19-21-11-7-4-8-12-21)18-27-30-25(28-29-26(30)33)16-14-20-9-5-3-6-10-20/h3-13,15,17-18H,2,14,16,19H2,1H3,(H,29,33)/b27-18- |
| InChIKey | WVJFEPYPSRJDPN-IMRQLAEWSA-N |
| XLogP | 5.59 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|