About 2-butyl-4-prop-2-enyl-2,5-dihydrofuran
2-butyl-4-prop-2-enyl-2,5-dihydrofuran (PubChem CID 11052025) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 2-butyl-4-prop-2-enyl-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 2-butyl-4-prop-2-enyl-2,5-dihydrofuran |
| PubChem CID | 11052025 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2-butyl-4-prop-2-enyl-2,5-dihydrofuran |
| SMILES | C=CCC1=CC(CCCC)OC1 |
| InChI | InChI=1S/C11H18O/c1-3-5-7-11-8-10(6-4-2)9-12-11/h4,8,11H,2-3,5-7,9H2,1H3 |
| InChIKey | HXPQTLWGAFZKLL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-4-prop-2-enyl-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4-prop-2-enyl-2,5-dihydrofuran?
The IUPAC name of 2-butyl-4-prop-2-enyl-2,5-dihydrofuran (CID 11052025) is 2-butyl-4-prop-2-enyl-2,5-dihydrofuran.
What is the SMILES notation for 2-butyl-4-prop-2-enyl-2,5-dihydrofuran?
The canonical SMILES for 2-butyl-4-prop-2-enyl-2,5-dihydrofuran is C=CCC1=CC(CCCC)OC1.
What is the InChIKey of 2-butyl-4-prop-2-enyl-2,5-dihydrofuran?
The InChIKey is HXPQTLWGAFZKLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-3-5-7-11-8-10(6-4-2)9-12-11/h4,8,11H,2-3,5-7,9H2,1H3.
What are the key properties of 2-butyl-4-prop-2-enyl-2,5-dihydrofuran?
2-butyl-4-prop-2-enyl-2,5-dihydrofuran has a molecular weight of 166.26 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4-prop-2-enyl-2,5-dihydrofuran is sourced from PubChem (CID 11052025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).