C11H18O — CID 11052025
2-butyl-4-prop-2-enyl-2,5-dihydrofuran (PubChem CID 11052025) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 2-butyl-4-prop-2-enyl-2,5-dihydrofuran.
| Compound Name | 2-butyl-4-prop-2-enyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 11052025 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2-butyl-4-prop-2-enyl-2,5-dihydrofuran |
| SMILES | C=CCC1=CC(CCCC)OC1 |
| InChI | InChI=1S/C11H18O/c1-3-5-7-11-8-10(6-4-2)9-12-11/h4,8,11H,2-3,5-7,9H2,1H3 |
| InChIKey | HXPQTLWGAFZKLL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|