C24H22N4OS — CID 110520308
3-phenyl-4-[(Z)-[4-(3-phenylpropoxy)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 110520308) has the molecular formula C24H22N4OS and a molecular weight of 414.53 g/mol. Its IUPAC name is 3-phenyl-4-[(Z)-[4-(3-phenylpropoxy)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-phenyl-4-[(Z)-[4-(3-phenylpropoxy)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110520308 |
| Molecular Formula | C24H22N4OS |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 3-phenyl-4-[(Z)-[4-(3-phenylpropoxy)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccccc2)n1/N=C\c1ccc(OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N4OS/c30-24-27-26-23(21-11-5-2-6-12-21)28(24)25-18-20-13-15-22(16-14-20)29-17-7-10-19-8-3-1-4-9-19/h1-6,8-9,11-16,18H,7,10,17H2,(H,27,30)/b25-18- |
| InChIKey | PPMRXRQYCVMRTR-BWAHOGKJSA-N |
| XLogP | 5.50 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|