C18H19N5O4S2 — CID 110520534
4-[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 110520534) has the molecular formula C18H19N5O4S2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 4-[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110520534 |
| Molecular Formula | C18H19N5O4S2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 4-[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCOc1c(OC)cc(/C=N\n2c(-c3cccs3)n[nH]c2=S)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N5O4S2/c1-3-4-7-27-16-13(23(24)25)9-12(10-14(16)26-2)11-19-22-17(20-21-18(22)28)15-6-5-8-29-15/h5-6,8-11H,3-4,7H2,1-2H3,(H,21,28)/b19-11- |
| InChIKey | RLTBILUIZMFSHS-ODLFYWEKSA-N |
| XLogP | 4.65 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|