C21H17ClN4O2S2 — CID 110520588
4-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 110520588) has the molecular formula C21H17ClN4O2S2 and a molecular weight of 456.98 g/mol. Its IUPAC name is 4-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110520588 |
| Molecular Formula | C21H17ClN4O2S2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 4-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(/C=N\n2c(-c3cccs3)n[nH]c2=S)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H17ClN4O2S2/c1-27-18-11-14(7-8-17(18)28-13-15-4-2-5-16(22)10-15)12-23-26-20(24-25-21(26)29)19-6-3-9-30-19/h2-12H,13H2,1H3,(H,25,29)/b23-12- |
| InChIKey | JLVWVCZRTLDKCV-FMCGGJTJSA-N |
| XLogP | 5.79 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|