C11H23N — CID 11052065
(3R,5S)-3-butyl-2,2,5-trimethylpyrrolidine (PubChem CID 11052065) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is (3R,5S)-3-butyl-2,2,5-trimethylpyrrolidine.
| Compound Name | (3R,5S)-3-butyl-2,2,5-trimethylpyrrolidine |
|---|---|
| PubChem CID | 11052065 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (3R,5S)-3-butyl-2,2,5-trimethylpyrrolidine |
| SMILES | CCCC[C@@H]1C[C@H](C)NC1(C)C |
| InChI | InChI=1S/C11H23N/c1-5-6-7-10-8-9(2)12-11(10,3)4/h9-10,12H,5-8H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | PPQPIWLCFLHJSR-VHSXEESVSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |