About tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione
tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione (PubChem CID 11052184) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione.
Molecular Properties
| Compound Name | tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione |
| PubChem CID | 11052184 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione |
| SMILES | O=C1CC2CCC3C=CC(=O)C32C1 |
| InChI | InChI=1S/C11H12O2/c12-9-5-8-2-1-7-3-4-10(13)11(7,8)6-9/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | WGDUMRHMXHNLCL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione?
The IUPAC name of tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione (CID 11052184) is tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione.
What is the SMILES notation for tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione?
The canonical SMILES for tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione is O=C1CC2CCC3C=CC(=O)C32C1.
What is the InChIKey of tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione?
The InChIKey is WGDUMRHMXHNLCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c12-9-5-8-2-1-7-3-4-10(13)11(7,8)6-9/h3-4,7-8H,1-2,5-6H2.
What are the key properties of tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione?
tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione has a molecular weight of 176.22 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.3.0.01,5]undec-3-ene-2,10-dione is sourced from PubChem (CID 11052184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).