About N'-ethyl-N'-phenylacetohydrazide
N'-ethyl-N'-phenylacetohydrazide (PubChem CID 11052213) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is N'-ethyl-N'-phenylacetohydrazide.
Molecular Properties
| Compound Name | N'-ethyl-N'-phenylacetohydrazide |
| PubChem CID | 11052213 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | N'-ethyl-N'-phenylacetohydrazide |
| SMILES | CCN(NC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C10H14N2O/c1-3-12(11-9(2)13)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3,(H,11,13) |
| InChIKey | YOSUBCIAZLZLOY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N'-phenylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-phenylacetohydrazide?
The IUPAC name of N'-ethyl-N'-phenylacetohydrazide (CID 11052213) is N'-ethyl-N'-phenylacetohydrazide.
What is the SMILES notation for N'-ethyl-N'-phenylacetohydrazide?
The canonical SMILES for N'-ethyl-N'-phenylacetohydrazide is CCN(NC(C)=O)c1ccccc1.
What is the InChIKey of N'-ethyl-N'-phenylacetohydrazide?
The InChIKey is YOSUBCIAZLZLOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-3-12(11-9(2)13)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3,(H,11,13).
What are the key properties of N'-ethyl-N'-phenylacetohydrazide?
N'-ethyl-N'-phenylacetohydrazide has a molecular weight of 178.23 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-phenylacetohydrazide is sourced from PubChem (CID 11052213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).