About 6-(2-methyl-1,3-dioxolan-2-yl)hexanal
6-(2-methyl-1,3-dioxolan-2-yl)hexanal (PubChem CID 11052346) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 6-(2-methyl-1,3-dioxolan-2-yl)hexanal.
Molecular Properties
| Compound Name | 6-(2-methyl-1,3-dioxolan-2-yl)hexanal |
| PubChem CID | 11052346 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 6-(2-methyl-1,3-dioxolan-2-yl)hexanal |
| SMILES | CC1(CCCCCC=O)OCCO1 |
| InChI | InChI=1S/C10H18O3/c1-10(12-8-9-13-10)6-4-2-3-5-7-11/h7H,2-6,8-9H2,1H3 |
| InChIKey | OSUUKELWLSBXKB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-methyl-1,3-dioxolan-2-yl)hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methyl-1,3-dioxolan-2-yl)hexanal?
The IUPAC name of 6-(2-methyl-1,3-dioxolan-2-yl)hexanal (CID 11052346) is 6-(2-methyl-1,3-dioxolan-2-yl)hexanal.
What is the SMILES notation for 6-(2-methyl-1,3-dioxolan-2-yl)hexanal?
The canonical SMILES for 6-(2-methyl-1,3-dioxolan-2-yl)hexanal is CC1(CCCCCC=O)OCCO1.
What is the InChIKey of 6-(2-methyl-1,3-dioxolan-2-yl)hexanal?
The InChIKey is OSUUKELWLSBXKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-10(12-8-9-13-10)6-4-2-3-5-7-11/h7H,2-6,8-9H2,1H3.
What are the key properties of 6-(2-methyl-1,3-dioxolan-2-yl)hexanal?
6-(2-methyl-1,3-dioxolan-2-yl)hexanal has a molecular weight of 186.25 g/mol, XLogP of 1.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methyl-1,3-dioxolan-2-yl)hexanal is sourced from PubChem (CID 11052346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).