C10H18O3 — CID 11052349
[(2S,3R)-3-[(2R,3S)-3-pentyloxiran-2-yl]oxiran-2-yl]methanol (PubChem CID 11052349) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is [(2S,3R)-3-[(2R,3S)-3-pentyloxiran-2-yl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3R)-3-[(2R,3S)-3-pentyloxiran-2-yl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11052349 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | [(2S,3R)-3-[(2R,3S)-3-pentyloxiran-2-yl]oxiran-2-yl]methanol |
| SMILES | CCCCC[C@@H]1O[C@H]1[C@@H]1O[C@H]1CO |
| InChI | InChI=1S/C10H18O3/c1-2-3-4-5-7-9(12-7)10-8(6-11)13-10/h7-11H,2-6H2,1H3/t7-,8-,9+,10+/m0/s1 |
| InChIKey | NFDFSRDYBWUZTA-AXTSPUMRSA-N |
| XLogP | 1.09 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|