C17H19N3O3 — CID 110523602
1-methyl-2-oxo-N-[(Z)-(2-propoxyphenyl)methylideneamino]pyridine-3-carboxamide (PubChem CID 110523602) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-[(Z)-(2-propoxyphenyl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | 1-methyl-2-oxo-N-[(Z)-(2-propoxyphenyl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110523602 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-methyl-2-oxo-N-[(Z)-(2-propoxyphenyl)methylideneamino]pyridine-3-carboxamide |
| SMILES | CCCOc1ccccc1/C=N\NC(=O)c1cccn(C)c1=O |
| InChI | InChI=1S/C17H19N3O3/c1-3-11-23-15-9-5-4-7-13(15)12-18-19-16(21)14-8-6-10-20(2)17(14)22/h4-10,12H,3,11H2,1-2H3,(H,19,21)/b18-12- |
| InChIKey | ZJFRXJKJSJFXMJ-PDGQHHTCSA-N |
| XLogP | 1.94 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|