C18H20BrN3O4 — CID 110523765
N-[(Z)-(2-bromo-3,4-dimethoxyphenyl)methylideneamino]-2-oxo-1-propan-2-ylpyridine-3-carboxamide (PubChem CID 110523765) has the molecular formula C18H20BrN3O4 and a molecular weight of 422.28 g/mol. Its IUPAC name is N-[(Z)-(2-bromo-3,4-dimethoxyphenyl)methylideneamino]-2-oxo-1-propan-2-ylpyridine-3-carboxamide.
| Compound Name | N-[(Z)-(2-bromo-3,4-dimethoxyphenyl)methylideneamino]-2-oxo-1-propan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 110523765 |
| Molecular Formula | C18H20BrN3O4 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | N-[(Z)-(2-bromo-3,4-dimethoxyphenyl)methylideneamino]-2-oxo-1-propan-2-ylpyridine-3-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2cccn(C(C)C)c2=O)c(Br)c1OC |
| InChI | InChI=1S/C18H20BrN3O4/c1-11(2)22-9-5-6-13(18(22)24)17(23)21-20-10-12-7-8-14(25-3)16(26-4)15(12)19/h5-11H,1-4H3,(H,21,23)/b20-10- |
| InChIKey | RTMOWEZCNFNVOG-JMIUGGIZSA-N |
| XLogP | 2.97 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|