C23H24N2O — CID 110524921
N-[(Z)-(4-tert-butylphenyl)methylideneamino]-2-methylnaphthalene-1-carboxamide (PubChem CID 110524921) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[(Z)-(4-tert-butylphenyl)methylideneamino]-2-methylnaphthalene-1-carboxamide.
| Compound Name | N-[(Z)-(4-tert-butylphenyl)methylideneamino]-2-methylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 110524921 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[(Z)-(4-tert-butylphenyl)methylideneamino]-2-methylnaphthalene-1-carboxamide |
| SMILES | Cc1ccc2ccccc2c1C(=O)N/N=C\c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H24N2O/c1-16-9-12-18-7-5-6-8-20(18)21(16)22(26)25-24-15-17-10-13-19(14-11-17)23(2,3)4/h5-15H,1-4H3,(H,25,26)/b24-15- |
| InChIKey | USFLEPUPXUJDAK-IWIPYMOSSA-N |
| XLogP | 5.21 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|