C10H11NO3 — CID 11052495
(3aR)-1,3a-dimethyl-4,6-dihydroindole-2,3,5-trione (PubChem CID 11052495) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is (3aR)-1,3a-dimethyl-4,6-dihydroindole-2,3,5-trione.
| Compound Name | (3aR)-1,3a-dimethyl-4,6-dihydroindole-2,3,5-trione |
|---|---|
| PubChem CID | 11052495 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (3aR)-1,3a-dimethyl-4,6-dihydroindole-2,3,5-trione |
| SMILES | CN1C(=O)C(=O)[C@]2(C)CC(=O)CC=C12 |
| InChI | InChI=1S/C10H11NO3/c1-10-5-6(12)3-4-7(10)11(2)9(14)8(10)13/h4H,3,5H2,1-2H3/t10-/m1/s1 |
| InChIKey | TYMCRCCJCDBJHS-SNVBAGLBSA-N |
| XLogP | 0.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|