About 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one
6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one (PubChem CID 11052517) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one |
| PubChem CID | 11052517 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one |
| SMILES | C=CCC1=CC(OC)(OC)C(=O)C=C1 |
| InChI | InChI=1S/C11H14O3/c1-4-5-9-6-7-10(12)11(8-9,13-2)14-3/h4,6-8H,1,5H2,2-3H3 |
| InChIKey | GDIWCIHDSMOYGZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one?
The IUPAC name of 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one (CID 11052517) is 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one is C=CCC1=CC(OC)(OC)C(=O)C=C1.
What is the InChIKey of 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one?
The InChIKey is GDIWCIHDSMOYGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-4-5-9-6-7-10(12)11(8-9,13-2)14-3/h4,6-8H,1,5H2,2-3H3.
What are the key properties of 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one?
6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one has a molecular weight of 194.23 g/mol, XLogP of 1.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 11052517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).