C10H18N2O2 — CID 11052601
(2R,5R)-3,6-diethoxy-2,5-dimethyl-2,5-dihydropyrazine (PubChem CID 11052601) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is (2R,5R)-3,6-diethoxy-2,5-dimethyl-2,5-dihydropyrazine.
| Compound Name | (2R,5R)-3,6-diethoxy-2,5-dimethyl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 11052601 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (2R,5R)-3,6-diethoxy-2,5-dimethyl-2,5-dihydropyrazine |
| SMILES | CCOC1=N[C@H](C)C(OCC)=N[C@@H]1C |
| InChI | InChI=1S/C10H18N2O2/c1-5-13-9-7(3)12-10(14-6-2)8(4)11-9/h7-8H,5-6H2,1-4H3/t7-,8-/m1/s1 |
| InChIKey | QUTCCXQYVFPNOZ-HTQZYQBOSA-N |
| XLogP | 1.65 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |