C20H16Cl2N4O — CID 110527608
N-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide (PubChem CID 110527608) has the molecular formula C20H16Cl2N4O and a molecular weight of 399.28 g/mol. Its IUPAC name is N-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110527608 |
| Molecular Formula | C20H16Cl2N4O |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
| SMILES | O=C(N/N=C/c1c(Cl)cccc1Cl)c1nn(-c2ccccc2)c2c1CCC2 |
| InChI | InChI=1S/C20H16Cl2N4O/c21-16-9-5-10-17(22)15(16)12-23-24-20(27)19-14-8-4-11-18(14)26(25-19)13-6-2-1-3-7-13/h1-3,5-7,9-10,12H,4,8,11H2,(H,24,27)/b23-12+ |
| InChIKey | VGOWDRXGRHDMCH-FSJBWODESA-N |
| XLogP | 4.43 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|