About 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene
1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene (PubChem CID 11052806) has the molecular formula C9H6ClF3
and a molecular weight of 206.59 g/mol. Its IUPAC name is 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene.
Molecular Properties
| Compound Name | 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
| PubChem CID | 11052806 |
| Molecular Formula | C9H6ClF3 |
| Molecular Weight | 206.59 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
| SMILES | FC(F)(F)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H6ClF3/c10-8-3-1-7(2-4-8)5-6-9(11,12)13/h1-6H/b6-5+ |
| InChIKey | HUUZVGMNQBUBMM-AATRIKPKSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene?
The IUPAC name of 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene (CID 11052806) is 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene.
What is the SMILES notation for 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene?
The canonical SMILES for 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene is FC(F)(F)/C=C/c1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene?
The InChIKey is HUUZVGMNQBUBMM-AATRIKPKSA-N. The full InChI is InChI=1S/C9H6ClF3/c10-8-3-1-7(2-4-8)5-6-9(11,12)13/h1-6H/b6-5+.
What are the key properties of 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene?
1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene has a molecular weight of 206.59 g/mol, XLogP of 3.92, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene is sourced from PubChem (CID 11052806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).