About CID 11052814
CID 11052814 (PubChem CID 11052814) has the molecular formula C7H15N2Se
and a molecular weight of 206.17 g/mol.
Molecular Properties
| Compound Name | CID 11052814 |
| PubChem CID | 11052814 |
| Molecular Formula | C7H15N2Se |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | — |
| SMILES | CCCC/N=C(\[Se])N(C)C |
| InChI | InChI=1S/C7H15N2Se/c1-4-5-6-8-7(10)9(2)3/h4-6H2,1-3H3/b8-7- |
| InChIKey | IMXQICFMMQUAHT-FPLPWBNLSA-N |
| XLogP | 0.87 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 11052814 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11052814?
The IUPAC name of CID 11052814 (CID 11052814) is not available.
What is the SMILES notation for CID 11052814?
The canonical SMILES for CID 11052814 is CCCC/N=C(\[Se])N(C)C.
What is the InChIKey of CID 11052814?
The InChIKey is IMXQICFMMQUAHT-FPLPWBNLSA-N. The full InChI is InChI=1S/C7H15N2Se/c1-4-5-6-8-7(10)9(2)3/h4-6H2,1-3H3/b8-7-.
What are the key properties of CID 11052814?
CID 11052814 has a molecular weight of 206.17 g/mol, XLogP of 0.87, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11052814 is sourced from PubChem (CID 11052814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).