C26H24N2O2S — CID 110528894
[3,4-dimethyl-6-(4-phenylmethoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone (PubChem CID 110528894) has the molecular formula C26H24N2O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is [3,4-dimethyl-6-(4-phenylmethoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone.
| Compound Name | [3,4-dimethyl-6-(4-phenylmethoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110528894 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [3,4-dimethyl-6-(4-phenylmethoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
| SMILES | CC1=C(C(=O)c2ccccc2)C(c2ccc(OCc3ccccc3)cc2)NC(=S)N1C |
| InChI | InChI=1S/C26H24N2O2S/c1-18-23(25(29)21-11-7-4-8-12-21)24(27-26(31)28(18)2)20-13-15-22(16-14-20)30-17-19-9-5-3-6-10-19/h3-16,24H,17H2,1-2H3,(H,27,31) |
| InChIKey | NLBTYKWOSAMHIZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|