C21H21N3O3S — CID 110529538
2-[4-(5-acetyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)phenoxy]-N-phenylacetamide (PubChem CID 110529538) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-[4-(5-acetyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)phenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-(5-acetyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 110529538 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[4-(5-acetyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)phenoxy]-N-phenylacetamide |
| SMILES | CC(=O)C1=C(C)NC(=S)NC1c1ccc(OCC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-13-19(14(2)25)20(24-21(28)22-13)15-8-10-17(11-9-15)27-12-18(26)23-16-6-4-3-5-7-16/h3-11,20H,12H2,1-2H3,(H,23,26)(H2,22,24,28) |
| InChIKey | WLXGOKYSAONYDZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|