C14H14Br2N2O2S — CID 110529661
1-[4-(3,5-dibromo-4-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone (PubChem CID 110529661) has the molecular formula C14H14Br2N2O2S and a molecular weight of 434.15 g/mol. Its IUPAC name is 1-[4-(3,5-dibromo-4-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone.
| Compound Name | 1-[4-(3,5-dibromo-4-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 110529661 |
| Molecular Formula | C14H14Br2N2O2S |
| Molecular Weight | 434.15 g/mol |
| Exact Mass | 431.91 |
| IUPAC Name | 1-[4-(3,5-dibromo-4-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
| SMILES | COc1c(Br)cc(C2NC(=S)NC(C)=C2C(C)=O)cc1Br |
| InChI | InChI=1S/C14H14Br2N2O2S/c1-6-11(7(2)19)12(18-14(21)17-6)8-4-9(15)13(20-3)10(16)5-8/h4-5,12H,1-3H3,(H2,17,18,21) |
| InChIKey | IIUSMZBWWCWFBU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.15 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|