C11H20O4 — CID 11053075
(1S)-1-[(2R,4S,5R,6R)-4-hydroxy-5-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]ethane-1,2-diol (PubChem CID 11053075) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is (1S)-1-[(2R,4S,5R,6R)-4-hydroxy-5-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(2R,4S,5R,6R)-4-hydroxy-5-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 11053075 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (1S)-1-[(2R,4S,5R,6R)-4-hydroxy-5-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]ethane-1,2-diol |
| SMILES | C/C=C/[C@H]1O[C@@H]([C@@H](O)CO)C[C@H](O)[C@H]1C |
| InChI | InChI=1S/C11H20O4/c1-3-4-10-7(2)8(13)5-11(15-10)9(14)6-12/h3-4,7-14H,5-6H2,1-2H3/b4-3+/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | BQOIQUQEDHFNFY-QPXONINNSA-N |
| XLogP | 0.07 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|