C19H17Cl2N3OS — CID 110532113
N-[(Z)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-5-methyl-4-phenyl-1,3-thiazol-2-amine (PubChem CID 110532113) has the molecular formula C19H17Cl2N3OS and a molecular weight of 406.34 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-5-methyl-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-5-methyl-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110532113 |
| Molecular Formula | C19H17Cl2N3OS |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-5-methyl-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CCOc1c(Cl)cc(/C=N\Nc2nc(-c3ccccc3)c(C)s2)cc1Cl |
| InChI | InChI=1S/C19H17Cl2N3OS/c1-3-25-18-15(20)9-13(10-16(18)21)11-22-24-19-23-17(12(2)26-19)14-7-5-4-6-8-14/h4-11H,3H2,1-2H3,(H,23,24)/b22-11- |
| InChIKey | IEMDAAPGBWPCBK-JJFYIABZSA-N |
| XLogP | 6.27 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|