About 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole
2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole (PubChem CID 110532332) has the molecular formula C15H11BrCl2N2O2
and a molecular weight of 402.08 g/mol. Its IUPAC name is 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole |
| PubChem CID | 110532332 |
| Molecular Formula | C15H11BrCl2N2O2 |
| Molecular Weight | 402.08 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole |
| SMILES | COc1ccc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)c(Br)c1OC |
| InChI | InChI=1S/C15H11BrCl2N2O2/c1-21-12-4-3-7(13(16)14(12)22-2)15-19-10-5-8(17)9(18)6-11(10)20-15/h3-6H,1-2H3,(H,19,20) |
| InChIKey | KOCMXVPHWTVMRU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.08 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole?
The IUPAC name of 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole (CID 110532332) is 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole.
What is the SMILES notation for 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole?
The canonical SMILES for 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole is COc1ccc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)c(Br)c1OC.
What is the InChIKey of 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole?
The InChIKey is KOCMXVPHWTVMRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrCl2N2O2/c1-21-12-4-3-7(13(16)14(12)22-2)15-19-10-5-8(17)9(18)6-11(10)20-15/h3-6H,1-2H3,(H,19,20).
What are the key properties of 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole?
2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole has a molecular weight of 402.08 g/mol, XLogP of 5.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-3,4-dimethoxyphenyl)-5,6-dichloro-1H-benzimidazole is sourced from PubChem (CID 110532332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).