C23H27N3OS — CID 110532880
N-[(Z)-[4-(2-methylpropoxy)phenyl]methylideneamino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine (PubChem CID 110532880) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is N-[(Z)-[4-(2-methylpropoxy)phenyl]methylideneamino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-[4-(2-methylpropoxy)phenyl]methylideneamino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110532880 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-[(Z)-[4-(2-methylpropoxy)phenyl]methylideneamino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1cc(C)c(-c2csc(N/N=C\c3ccc(OCC(C)C)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C23H27N3OS/c1-15(2)13-27-20-8-6-19(7-9-20)12-24-26-23-25-21(14-28-23)22-17(4)10-16(3)11-18(22)5/h6-12,14-15H,13H2,1-5H3,(H,25,26)/b24-12- |
| InChIKey | VXXYDSQISCVUQF-MSXFZWOLSA-N |
| XLogP | 6.22 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|