C13H22O3 — CID 11053351
propan-2-yl (2R,3R)-2,3-bis(ethenyl)-2-hydroxyhexanoate (PubChem CID 11053351) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is propan-2-yl (2R,3R)-2,3-bis(ethenyl)-2-hydroxyhexanoate.
| Compound Name | propan-2-yl (2R,3R)-2,3-bis(ethenyl)-2-hydroxyhexanoate |
|---|---|
| PubChem CID | 11053351 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | propan-2-yl (2R,3R)-2,3-bis(ethenyl)-2-hydroxyhexanoate |
| SMILES | C=C[C@@H](CCC)[C@](O)(C=C)C(=O)OC(C)C |
| InChI | InChI=1S/C13H22O3/c1-6-9-11(7-2)13(15,8-3)12(14)16-10(4)5/h7-8,10-11,15H,2-3,6,9H2,1,4-5H3/t11-,13+/m0/s1 |
| InChIKey | ASQFXGPJSLIDNU-WCQYABFASA-N |
| XLogP | 2.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|