C14H16BrN3O2S — CID 110534352
N-[(Z)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 110534352) has the molecular formula C14H16BrN3O2S and a molecular weight of 370.27 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110534352 |
| Molecular Formula | C14H16BrN3O2S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | N-[(Z)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | COc1cc(Br)cc(/C=N\Nc2nc(C)c(C)s2)c1OC |
| InChI | InChI=1S/C14H16BrN3O2S/c1-8-9(2)21-14(17-8)18-16-7-10-5-11(15)6-12(19-3)13(10)20-4/h5-7H,1-4H3,(H,17,18)/b16-7- |
| InChIKey | RGPXJRFDPKIWNV-APSNUPSMSA-N |
| XLogP | 3.99 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|