C17H23Cl2N3O — CID 110535383
3-(3,5-dichloro-4-propan-2-yloxyphenyl)-5-ethyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine (PubChem CID 110535383) has the molecular formula C17H23Cl2N3O and a molecular weight of 356.30 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-propan-2-yloxyphenyl)-5-ethyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine.
| Compound Name | 3-(3,5-dichloro-4-propan-2-yloxyphenyl)-5-ethyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 110535383 |
| Molecular Formula | C17H23Cl2N3O |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 3-(3,5-dichloro-4-propan-2-yloxyphenyl)-5-ethyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine |
| SMILES | CCN1CCC2=NNC(c3cc(Cl)c(OC(C)C)c(Cl)c3)C2C1 |
| InChI | InChI=1S/C17H23Cl2N3O/c1-4-22-6-5-15-12(9-22)16(21-20-15)11-7-13(18)17(14(19)8-11)23-10(2)3/h7-8,10,12,16,21H,4-6,9H2,1-3H3 |
| InChIKey | ILWQPYRJSKEYTB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |