C14H18O3 — CID 11053576
[(1S,2R,3R,6S,7S,8R)-6-hydroxy-4-methyl-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] acetate (PubChem CID 11053576) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is [(1S,2R,3R,6S,7S,8R)-6-hydroxy-4-methyl-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] acetate.
| Compound Name | [(1S,2R,3R,6S,7S,8R)-6-hydroxy-4-methyl-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] acetate |
|---|---|
| PubChem CID | 11053576 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | [(1S,2R,3R,6S,7S,8R)-6-hydroxy-4-methyl-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] acetate |
| SMILES | CC(=O)O[C@H]1C(C)=C[C@@H](O)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C14H18O3/c1-7-5-11(16)12-9-3-4-10(6-9)13(12)14(7)17-8(2)15/h3-5,9-14,16H,6H2,1-2H3/t9-,10+,11+,12+,13+,14-/m0/s1 |
| InChIKey | AOLRNQVUPDNWQO-NFTYFPCCSA-N |
| XLogP | 1.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|